C11H11NO3 — CID 137320753
methyl N-(3-prop-2-ynoxyphenyl)carbamate (PubChem CID 137320753) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is methyl N-(3-prop-2-ynoxyphenyl)carbamate.
| Compound Name | methyl N-(3-prop-2-ynoxyphenyl)carbamate |
|---|---|
| PubChem CID | 137320753 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | methyl N-(3-prop-2-ynoxyphenyl)carbamate |
| SMILES | C#CCOc1cccc(NC(=O)OC)c1 |
| InChI | InChI=1S/C11H11NO3/c1-3-7-15-10-6-4-5-9(8-10)12-11(13)14-2/h1,4-6,8H,7H2,2H3,(H,12,13) |
| InChIKey | OYTIJZDZMSNNSC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|