C18H15ClN2O3 — CID 146450953
3-[(2-chloroacetyl)amino]-N-(3-prop-2-ynoxyphenyl)benzamide (PubChem CID 146450953) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)amino]-N-(3-prop-2-ynoxyphenyl)benzamide.
| Compound Name | 3-[(2-chloroacetyl)amino]-N-(3-prop-2-ynoxyphenyl)benzamide |
|---|---|
| PubChem CID | 146450953 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 3-[(2-chloroacetyl)amino]-N-(3-prop-2-ynoxyphenyl)benzamide |
| SMILES | C#CCOc1cccc(NC(=O)c2cccc(NC(=O)CCl)c2)c1 |
| InChI | InChI=1S/C18H15ClN2O3/c1-2-9-24-16-8-4-7-15(11-16)21-18(23)13-5-3-6-14(10-13)20-17(22)12-19/h1,3-8,10-11H,9,12H2,(H,20,22)(H,21,23) |
| InChIKey | IKRFYUHWTVWQEK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|