C12H13NO3 — CID 154752881
N-(2-hydroxyethyl)-3-prop-2-ynoxybenzamide (PubChem CID 154752881) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-prop-2-ynoxybenzamide.
| Compound Name | N-(2-hydroxyethyl)-3-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 154752881 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-(2-hydroxyethyl)-3-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1cccc(C(=O)NCCO)c1 |
| InChI | InChI=1S/C12H13NO3/c1-2-8-16-11-5-3-4-10(9-11)12(15)13-6-7-14/h1,3-5,9,14H,6-8H2,(H,13,15) |
| InChIKey | CDLVBJJJYGUESF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|