C13H14N2O4 — CID 111448157
N-(2-hydroxyethyl)-3-(1,2-oxazol-3-ylmethoxy)benzamide (PubChem CID 111448157) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-(1,2-oxazol-3-ylmethoxy)benzamide.
| Compound Name | N-(2-hydroxyethyl)-3-(1,2-oxazol-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 111448157 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-(2-hydroxyethyl)-3-(1,2-oxazol-3-ylmethoxy)benzamide |
| SMILES | O=C(NCCO)c1cccc(OCc2ccon2)c1 |
| InChI | InChI=1S/C13H14N2O4/c16-6-5-14-13(17)10-2-1-3-12(8-10)18-9-11-4-7-19-15-11/h1-4,7-8,16H,5-6,9H2,(H,14,17) |
| InChIKey | LGFXDLIXKUCXMX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |