C18H21N3O3 — CID 71865812
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(3-prop-2-ynoxyphenyl)urea (PubChem CID 71865812) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(3-prop-2-ynoxyphenyl)urea.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(3-prop-2-ynoxyphenyl)urea |
|---|---|
| PubChem CID | 71865812 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(3-prop-2-ynoxyphenyl)urea |
| SMILES | C#CCOc1cccc(NC(=O)NCc2ncc(C(C)(C)C)o2)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-5-9-23-14-8-6-7-13(10-14)21-17(22)20-12-16-19-11-15(24-16)18(2,3)4/h1,6-8,10-11H,9,12H2,2-4H3,(H2,20,21,22) |
| InChIKey | ZVEUFBIGEDOHPS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|