C22H34N3O2+ — CID 11931977
3-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-N,N-diethylbenzamide (PubChem CID 11931977) has the molecular formula C22H34N3O2+ and a molecular weight of 372.53 g/mol. Its IUPAC name is 3-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 11931977 |
| Molecular Formula | C22H34N3O2+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 3-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)C[NH+]2CC[C@@H]3CCCC[C@@H]3C2)c1 |
| InChI | InChI=1S/C22H33N3O2/c1-3-25(4-2)22(27)18-10-7-11-20(14-18)23-21(26)16-24-13-12-17-8-5-6-9-19(17)15-24/h7,10-11,14,17,19H,3-6,8-9,12-13,15-16H2,1-2H3,(H,23,26)/p+1/t17-,19+/m0/s1 |
| InChIKey | UKPYZDFXAGUOGS-PKOBYXMFSA-O |
| XLogP | 2.20 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |