C21H31N4O3S+ — CID 11940402
2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]acetamide (PubChem CID 11940402) has the molecular formula C21H31N4O3S+ and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 11940402 |
| Molecular Formula | C21H31N4O3S+ |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(C[NH+]1CC[C@@H]2CCCC[C@@H]2C1)Nc1cccc(S(=O)(=O)NC2=NCCC2)c1 |
| InChI | InChI=1S/C21H30N4O3S/c26-21(15-25-12-10-16-5-1-2-6-17(16)14-25)23-18-7-3-8-19(13-18)29(27,28)24-20-9-4-11-22-20/h3,7-8,13,16-17H,1-2,4-6,9-12,14-15H2,(H,22,24)(H,23,26)/p+1/t16-,17+/m0/s1 |
| InChIKey | LQLKVHGNXPJLCB-DLBZAZTESA-O |
| XLogP | 1.19 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |