C15H22N4O3S — CID 119676774
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-4-(methylamino)butanamide (PubChem CID 119676774) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119676774 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1cccc(S(=O)(=O)NC2=NCCC2)c1 |
| InChI | InChI=1S/C15H22N4O3S/c1-16-9-4-8-15(20)18-12-5-2-6-13(11-12)23(21,22)19-14-7-3-10-17-14/h2,5-6,11,16H,3-4,7-10H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | JBHSKSXWQCZVCU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|