C24H31N3O4S — CID 4826708
4-(4-tert-butylphenoxy)-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]butanamide (PubChem CID 4826708) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 4826708 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Nc2cccc(S(=O)(=O)NC3=NCCC3)c2)cc1 |
| InChI | InChI=1S/C24H31N3O4S/c1-24(2,3)18-11-13-20(14-12-18)31-16-6-10-23(28)26-19-7-4-8-21(17-19)32(29,30)27-22-9-5-15-25-22/h4,7-8,11-14,17H,5-6,9-10,15-16H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | QJGVOIBKEFNNPX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|