C12H13Cl2NO3S — CID 8785569
methyl 3-[2-(2,6-dichloroanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 8785569) has the molecular formula C12H13Cl2NO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is methyl 3-[2-(2,6-dichloroanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-(2,6-dichloroanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 8785569 |
| Molecular Formula | C12H13Cl2NO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | methyl 3-[2-(2,6-dichloroanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13Cl2NO3S/c1-18-11(17)5-6-19-7-10(16)15-12-8(13)3-2-4-9(12)14/h2-4H,5-7H2,1H3,(H,15,16) |
| InChIKey | NMQMFGUGKSUHCO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|