C12H12Cl2N2O3S — CID 54785946
methyl 4-[(2,6-dichlorophenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 54785946) has the molecular formula C12H12Cl2N2O3S and a molecular weight of 335.21 g/mol. Its IUPAC name is methyl 4-[(2,6-dichlorophenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[(2,6-dichlorophenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54785946 |
| Molecular Formula | C12H12Cl2N2O3S |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | methyl 4-[(2,6-dichlorophenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NC(=S)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O3S/c1-19-10(18)6-5-9(17)15-12(20)16-11-7(13)3-2-4-8(11)14/h2-4H,5-6H2,1H3,(H2,15,16,17,20) |
| InChIKey | OEVAJAZUXJBJDD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|