C15H23N3O3 — CID 109017161
N-(1,3-benzodioxol-5-yl)-3-[3-(dimethylamino)propylamino]propanamide (PubChem CID 109017161) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-[3-(dimethylamino)propylamino]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-[3-(dimethylamino)propylamino]propanamide |
|---|---|
| PubChem CID | 109017161 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-[3-(dimethylamino)propylamino]propanamide |
| SMILES | CN(C)CCCNCCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H23N3O3/c1-18(2)9-3-7-16-8-6-15(19)17-12-4-5-13-14(10-12)21-11-20-13/h4-5,10,16H,3,6-9,11H2,1-2H3,(H,17,19) |
| InChIKey | ZQZBVKJNXYDNII-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|