C14H16NO5- — CID 3424556
5-(1,3-benzodioxol-5-ylamino)-3,3-dimethyl-5-oxopentanoate (PubChem CID 3424556) has the molecular formula C14H16NO5- and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylamino)-3,3-dimethyl-5-oxopentanoate.
| Compound Name | 5-(1,3-benzodioxol-5-ylamino)-3,3-dimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 3424556 |
| Molecular Formula | C14H16NO5- |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylamino)-3,3-dimethyl-5-oxopentanoate |
| SMILES | CC(C)(CC(=O)[O-])CC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H17NO5/c1-14(2,7-13(17)18)6-12(16)15-9-3-4-10-11(5-9)20-8-19-10/h3-5H,6-8H2,1-2H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | RYEXWDNLTAIVKC-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |