C16H19N3O3 — CID 126443130
(2S)-N-(3-oxo-4H-1,4-benzoxazin-7-yl)-2-propan-2-yl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 126443130) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2S)-N-(3-oxo-4H-1,4-benzoxazin-7-yl)-2-propan-2-yl-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | (2S)-N-(3-oxo-4H-1,4-benzoxazin-7-yl)-2-propan-2-yl-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 126443130 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (2S)-N-(3-oxo-4H-1,4-benzoxazin-7-yl)-2-propan-2-yl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CC(C)[C@H]1C=CCN1C(=O)Nc1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C16H19N3O3/c1-10(2)13-4-3-7-19(13)16(21)17-11-5-6-12-14(8-11)22-9-15(20)18-12/h3-6,8,10,13H,7,9H2,1-2H3,(H,17,21)(H,18,20)/t13-/m1/s1 |
| InChIKey | SCTUHKZWDLNNKS-CYBMUJFWSA-N |
| XLogP | 2.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|