C18H20N4O2S — CID 119941075
N-pyridin-3-yl-4-[(2-thiomorpholin-3-ylacetyl)amino]benzamide (PubChem CID 119941075) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-pyridin-3-yl-4-[(2-thiomorpholin-3-ylacetyl)amino]benzamide.
| Compound Name | N-pyridin-3-yl-4-[(2-thiomorpholin-3-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 119941075 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-pyridin-3-yl-4-[(2-thiomorpholin-3-ylacetyl)amino]benzamide |
| SMILES | O=C(CC1CSCCN1)Nc1ccc(C(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C18H20N4O2S/c23-17(10-16-12-25-9-8-20-16)21-14-5-3-13(4-6-14)18(24)22-15-2-1-7-19-11-15/h1-7,11,16,20H,8-10,12H2,(H,21,23)(H,22,24) |
| InChIKey | MKDCAVDIIFNVIA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |