C19H24Cl2N4O2S — CID 119941733
N-(pyridin-3-ylmethyl)-2-[(2-thiomorpholin-3-ylacetyl)amino]benzamide;dihydrochloride (PubChem CID 119941733) has the molecular formula C19H24Cl2N4O2S and a molecular weight of 443.40 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-2-[(2-thiomorpholin-3-ylacetyl)amino]benzamide;dihydrochloride.
| Compound Name | N-(pyridin-3-ylmethyl)-2-[(2-thiomorpholin-3-ylacetyl)amino]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119941733 |
| Molecular Formula | C19H24Cl2N4O2S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-2-[(2-thiomorpholin-3-ylacetyl)amino]benzamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CSCCN1)Nc1ccccc1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C19H22N4O2S.2ClH/c24-18(10-15-13-26-9-8-21-15)23-17-6-2-1-5-16(17)19(25)22-12-14-4-3-7-20-11-14;;/h1-7,11,15,21H,8-10,12-13H2,(H,22,25)(H,23,24);2*1H |
| InChIKey | XKVOXCURFFVDDW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |