C15H20Cl2N4OS — CID 119941058
N-(2-imidazol-1-ylphenyl)-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941058) has the molecular formula C15H20Cl2N4OS and a molecular weight of 375.33 g/mol. Its IUPAC name is N-(2-imidazol-1-ylphenyl)-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-(2-imidazol-1-ylphenyl)-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941058 |
| Molecular Formula | C15H20Cl2N4OS |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-(2-imidazol-1-ylphenyl)-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CSCCN1)Nc1ccccc1-n1ccnc1 |
| InChI | InChI=1S/C15H18N4OS.2ClH/c20-15(9-12-10-21-8-6-17-12)18-13-3-1-2-4-14(13)19-7-5-16-11-19;;/h1-5,7,11-12,17H,6,8-10H2,(H,18,20);2*1H |
| InChIKey | ODHZLUCYUKIKKS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |