C10H20N2OS2 — CID 115734458
N-(4-ethylsulfanylbutan-2-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 115734458) has the molecular formula C10H20N2OS2 and a molecular weight of 248.42 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 115734458 |
| Molecular Formula | C10H20N2OS2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCSCCC(C)NC(=O)C1CSCN1 |
| InChI | InChI=1S/C10H20N2OS2/c1-3-14-5-4-8(2)12-10(13)9-6-15-7-11-9/h8-9,11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | HPHKOFTUUIMIOM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|