C15H22N2OS — CID 43707143
N-(3-methyl-1-phenylbutyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43707143) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is N-(3-methyl-1-phenylbutyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-methyl-1-phenylbutyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43707143 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-(3-methyl-1-phenylbutyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)CC(NC(=O)C1CSCN1)c1ccccc1 |
| InChI | InChI=1S/C15H22N2OS/c1-11(2)8-13(12-6-4-3-5-7-12)17-15(18)14-9-19-10-16-14/h3-7,11,13-14,16H,8-10H2,1-2H3,(H,17,18) |
| InChIKey | DQTMSOUHMRMIIT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |