C17H29ClN2OS — CID 119787657
N-(2-methyl-2-thiophen-2-ylpropyl)-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119787657) has the molecular formula C17H29ClN2OS and a molecular weight of 344.95 g/mol. Its IUPAC name is N-(2-methyl-2-thiophen-2-ylpropyl)-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-(2-methyl-2-thiophen-2-ylpropyl)-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119787657 |
| Molecular Formula | C17H29ClN2OS |
| Molecular Weight | 344.95 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-(2-methyl-2-thiophen-2-ylpropyl)-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCC(C)(C)c1cccs1)C1CCCNC1.Cl |
| InChI | InChI=1S/C17H28N2OS.ClH/c1-13(14-6-4-8-18-11-14)10-16(20)19-12-17(2,3)15-7-5-9-21-15;/h5,7,9,13-14,18H,4,6,8,10-12H2,1-3H3,(H,19,20);1H |
| InChIKey | VZQPHFVYAJFCBE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.95 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |