C18H25F3N2O2 — CID 119769268
3-piperidin-3-yl-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)butanamide (PubChem CID 119769268) has the molecular formula C18H25F3N2O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-piperidin-3-yl-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)butanamide.
| Compound Name | 3-piperidin-3-yl-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 119769268 |
| Molecular Formula | C18H25F3N2O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-piperidin-3-yl-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)butanamide |
| SMILES | CC(CC(=O)NCC(O)(c1ccccc1)C(F)(F)F)C1CCCNC1 |
| InChI | InChI=1S/C18H25F3N2O2/c1-13(14-6-5-9-22-11-14)10-16(24)23-12-17(25,18(19,20)21)15-7-3-2-4-8-15/h2-4,7-8,13-14,22,25H,5-6,9-12H2,1H3,(H,23,24) |
| InChIKey | VYYHYXIHAOXZSS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |