C14H29ClN2OS — CID 119790992
N-(2-methyl-2-methylsulfanylpropyl)-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119790992) has the molecular formula C14H29ClN2OS and a molecular weight of 308.92 g/mol. Its IUPAC name is N-(2-methyl-2-methylsulfanylpropyl)-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-(2-methyl-2-methylsulfanylpropyl)-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119790992 |
| Molecular Formula | C14H29ClN2OS |
| Molecular Weight | 308.92 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-(2-methyl-2-methylsulfanylpropyl)-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CSC(C)(C)CNC(=O)CC(C)C1CCCNC1.Cl |
| InChI | InChI=1S/C14H28N2OS.ClH/c1-11(12-6-5-7-15-9-12)8-13(17)16-10-14(2,3)18-4;/h11-12,15H,5-10H2,1-4H3,(H,16,17);1H |
| InChIKey | ASJOKEBPPNTIBI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.92 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |