C13H26N2O3 — CID 81044622
N-(2,3-dihydroxy-2-methylpropyl)-3-piperidin-3-ylbutanamide (PubChem CID 81044622) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is N-(2,3-dihydroxy-2-methylpropyl)-3-piperidin-3-ylbutanamide.
| Compound Name | N-(2,3-dihydroxy-2-methylpropyl)-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 81044622 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | N-(2,3-dihydroxy-2-methylpropyl)-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)NCC(C)(O)CO)C1CCCNC1 |
| InChI | InChI=1S/C13H26N2O3/c1-10(11-4-3-5-14-7-11)6-12(17)15-8-13(2,18)9-16/h10-11,14,16,18H,3-9H2,1-2H3,(H,15,17) |
| InChIKey | CWMDEEDELMBRAU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |