C16H18F2N2O4 — CID 51729577
N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 51729577) has the molecular formula C16H18F2N2O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 51729577 |
| Molecular Formula | C16H18F2N2O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | C[C@@H](NC(=O)CCN1C(=O)CCC1=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H18F2N2O4/c1-10(11-3-2-4-12(9-11)24-16(17)18)19-13(21)7-8-20-14(22)5-6-15(20)23/h2-4,9-10,16H,5-8H2,1H3,(H,19,21)/t10-/m1/s1 |
| InChIKey | BHHNVBVSAYZKTF-SNVBAGLBSA-N |
| XLogP | 2.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|