C16H17F2NO2S — CID 42961602
N-[1-[3-(difluoromethoxy)phenyl]ethyl]-3-thiophen-3-ylpropanamide (PubChem CID 42961602) has the molecular formula C16H17F2NO2S and a molecular weight of 325.38 g/mol. Its IUPAC name is N-[1-[3-(difluoromethoxy)phenyl]ethyl]-3-thiophen-3-ylpropanamide.
| Compound Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 42961602 |
| Molecular Formula | C16H17F2NO2S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]-3-thiophen-3-ylpropanamide |
| SMILES | CC(NC(=O)CCc1ccsc1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H17F2NO2S/c1-11(13-3-2-4-14(9-13)21-16(17)18)19-15(20)6-5-12-7-8-22-10-12/h2-4,7-11,16H,5-6H2,1H3,(H,19,20) |
| InChIKey | GGECUJSPRGOLGK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |