C18H16O7 — CID 24626688
methyl 2-[[2-(6-methoxy-1-benzofuran-3-yl)acetyl]oxymethyl]furan-3-carboxylate (PubChem CID 24626688) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is methyl 2-[[2-(6-methoxy-1-benzofuran-3-yl)acetyl]oxymethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[[2-(6-methoxy-1-benzofuran-3-yl)acetyl]oxymethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 24626688 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | methyl 2-[[2-(6-methoxy-1-benzofuran-3-yl)acetyl]oxymethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1COC(=O)Cc1coc2cc(OC)ccc12 |
| InChI | InChI=1S/C18H16O7/c1-21-12-3-4-13-11(9-24-15(13)8-12)7-17(19)25-10-16-14(5-6-23-16)18(20)22-2/h3-6,8-9H,7,10H2,1-2H3 |
| InChIKey | AHCGVDMKPRDEQH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |