C20H15NO6 — CID 4529583
(1,3-dioxoisoindol-2-yl)methyl 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 4529583) has the molecular formula C20H15NO6 and a molecular weight of 365.34 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 4529583 |
| Molecular Formula | C20H15NO6 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(CC(=O)OCN3C(=O)c4ccccc4C3=O)coc2c1 |
| InChI | InChI=1S/C20H15NO6/c1-25-13-6-7-14-12(10-26-17(14)9-13)8-18(22)27-11-21-19(23)15-4-2-3-5-16(15)20(21)24/h2-7,9-10H,8,11H2,1H3 |
| InChIKey | HYXKYYWXETUCCD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|