C19H14ClF2NO4S — CID 16528229
[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-chloro-4,5-difluorobenzoate (PubChem CID 16528229) has the molecular formula C19H14ClF2NO4S and a molecular weight of 425.84 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 16528229 |
| Molecular Formula | C19H14ClF2NO4S |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-chloro-4,5-difluorobenzoate |
| SMILES | COc1ccc(-c2nc(COC(=O)c3cc(F)c(F)cc3Cl)cs2)cc1OC |
| InChI | InChI=1S/C19H14ClF2NO4S/c1-25-16-4-3-10(5-17(16)26-2)18-23-11(9-28-18)8-27-19(24)12-6-14(21)15(22)7-13(12)20/h3-7,9H,8H2,1-2H3 |
| InChIKey | RRUNJWQQKYKUJQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|