C20H18FNO5S — CID 8611531
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2,3,4-trimethoxybenzoate (PubChem CID 8611531) has the molecular formula C20H18FNO5S and a molecular weight of 403.43 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2,3,4-trimethoxybenzoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 8611531 |
| Molecular Formula | C20H18FNO5S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2csc(-c3ccc(F)cc3)n2)c(OC)c1OC |
| InChI | InChI=1S/C20H18FNO5S/c1-24-16-9-8-15(17(25-2)18(16)26-3)20(23)27-10-14-11-28-19(22-14)12-4-6-13(21)7-5-12/h4-9,11H,10H2,1-3H3 |
| InChIKey | GKJCGUCDSGDLJT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |