C22H20N2O4 — CID 8568914
(5-phenyl-1,2-oxazol-3-yl)methyl 3-[[(E)-3-phenylprop-2-enoyl]amino]propanoate (PubChem CID 8568914) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (5-phenyl-1,2-oxazol-3-yl)methyl 3-[[(E)-3-phenylprop-2-enoyl]amino]propanoate.
| Compound Name | (5-phenyl-1,2-oxazol-3-yl)methyl 3-[[(E)-3-phenylprop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 8568914 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (5-phenyl-1,2-oxazol-3-yl)methyl 3-[[(E)-3-phenylprop-2-enoyl]amino]propanoate |
| SMILES | O=C(/C=C/c1ccccc1)NCCC(=O)OCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C22H20N2O4/c25-21(12-11-17-7-3-1-4-8-17)23-14-13-22(26)27-16-19-15-20(28-24-19)18-9-5-2-6-10-18/h1-12,15H,13-14,16H2,(H,23,25)/b12-11+ |
| InChIKey | DXUQFCKBHPRUHF-VAWYXSNFSA-N |
| XLogP | 3.60 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|