C20H19NO3 — CID 8568214
(5-phenyl-1,2-oxazol-3-yl)methyl 2-methyl-2-phenylpropanoate (PubChem CID 8568214) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (5-phenyl-1,2-oxazol-3-yl)methyl 2-methyl-2-phenylpropanoate.
| Compound Name | (5-phenyl-1,2-oxazol-3-yl)methyl 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 8568214 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (5-phenyl-1,2-oxazol-3-yl)methyl 2-methyl-2-phenylpropanoate |
| SMILES | CC(C)(C(=O)OCc1cc(-c2ccccc2)on1)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c1-20(2,16-11-7-4-8-12-16)19(22)23-14-17-13-18(24-21-17)15-9-5-3-6-10-15/h3-13H,14H2,1-2H3 |
| InChIKey | NTTBZZCIHLTKGU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |