C17H11ClFNO3S — CID 7880645
(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 7880645) has the molecular formula C17H11ClFNO3S and a molecular weight of 363.80 g/mol. Its IUPAC name is (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7880645 |
| Molecular Formula | C17H11ClFNO3S |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(F)c(Cl)c1)OCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C17H11ClFNO3S/c18-13-8-11(3-5-14(13)19)4-6-16(21)22-9-12-10-23-17(20-12)15-2-1-7-24-15/h1-8,10H,9H2/b6-4+ |
| InChIKey | NTCRIQWXSAUVIR-GQCTYLIASA-N |
| XLogP | 4.95 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|