C20H16F2N2O3 — CID 46793065
(3-methylquinoxalin-2-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 46793065) has the molecular formula C20H16F2N2O3 and a molecular weight of 370.36 g/mol. Its IUPAC name is (3-methylquinoxalin-2-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | (3-methylquinoxalin-2-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 46793065 |
| Molecular Formula | C20H16F2N2O3 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (3-methylquinoxalin-2-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | Cc1nc2ccccc2nc1COC(=O)/C=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H16F2N2O3/c1-13-18(24-17-5-3-2-4-16(17)23-13)12-26-19(25)11-8-14-6-9-15(10-7-14)27-20(21)22/h2-11,20H,12H2,1H3/b11-8+ |
| InChIKey | VWGMENZTEZTSPZ-DHZHZOJOSA-N |
| XLogP | 4.30 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|