C19H15NO4S — CID 7699897
4-ethyl-7-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]chromen-2-one (PubChem CID 7699897) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-ethyl-7-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]chromen-2-one.
| Compound Name | 4-ethyl-7-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 7699897 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 4-ethyl-7-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]chromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OCc3coc(-c4cccs4)n3)ccc12 |
| InChI | InChI=1S/C19H15NO4S/c1-2-12-8-18(21)24-16-9-14(5-6-15(12)16)22-10-13-11-23-19(20-13)17-4-3-7-25-17/h3-9,11H,2,10H2,1H3 |
| InChIKey | HZGHGLBVLYAHFD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|