C16H21N3O2S — CID 95678983
N'-[2-(2,5-dimethylphenoxy)ethoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide (PubChem CID 95678983) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)ethoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)ethoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
|---|---|
| PubChem CID | 95678983 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)ethoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
| SMILES | Cc1ccc(C)c(OCCO/N=C(/N)Cc2csc(C)n2)c1 |
| InChI | InChI=1S/C16H21N3O2S/c1-11-4-5-12(2)15(8-11)20-6-7-21-19-16(17)9-14-10-22-13(3)18-14/h4-5,8,10H,6-7,9H2,1-3H3,(H2,17,19) |
| InChIKey | UJDFIOVEJMFNDQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|