C14H15IN4O2S — CID 75136872
2-[[1-amino-2-(2-methyl-1,3-thiazol-4-yl)ethylidene]amino]oxy-N-(3-iodophenyl)acetamide (PubChem CID 75136872) has the molecular formula C14H15IN4O2S and a molecular weight of 430.27 g/mol. Its IUPAC name is 2-[[1-amino-2-(2-methyl-1,3-thiazol-4-yl)ethylidene]amino]oxy-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[[1-amino-2-(2-methyl-1,3-thiazol-4-yl)ethylidene]amino]oxy-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 75136872 |
| Molecular Formula | C14H15IN4O2S |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 2-[[1-amino-2-(2-methyl-1,3-thiazol-4-yl)ethylidene]amino]oxy-N-(3-iodophenyl)acetamide |
| SMILES | Cc1nc(CC(N)=NOCC(=O)Nc2cccc(I)c2)cs1 |
| InChI | InChI=1S/C14H15IN4O2S/c1-9-17-12(8-22-9)6-13(16)19-21-7-14(20)18-11-4-2-3-10(15)5-11/h2-5,8H,6-7H2,1H3,(H2,16,19)(H,18,20) |
| InChIKey | DUMYXLMWKMLTFW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|