C13H15N3O2S — CID 77103772
N'-hydroxy-2-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]ethanimidamide (PubChem CID 77103772) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N'-hydroxy-2-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 77103772 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N'-hydroxy-2-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]ethanimidamide |
| SMILES | Cc1nc(COc2ccc(CC(N)=NO)cc2)cs1 |
| InChI | InChI=1S/C13H15N3O2S/c1-9-15-11(8-19-9)7-18-12-4-2-10(3-5-12)6-13(14)16-17/h2-5,8,17H,6-7H2,1H3,(H2,14,16) |
| InChIKey | YWEKXIBDCRKRBV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|