C12H12ClN3O2S — CID 114323384
4-chloro-N'-hydroxy-2-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzenecarboximidamide (PubChem CID 114323384) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is 4-chloro-N'-hydroxy-2-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzenecarboximidamide.
| Compound Name | 4-chloro-N'-hydroxy-2-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 114323384 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 4-chloro-N'-hydroxy-2-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzenecarboximidamide |
| SMILES | Cc1nc(COc2cc(Cl)ccc2/C(N)=N/O)cs1 |
| InChI | InChI=1S/C12H12ClN3O2S/c1-7-15-9(6-19-7)5-18-11-4-8(13)2-3-10(11)12(14)16-17/h2-4,6,17H,5H2,1H3,(H2,14,16) |
| InChIKey | JZXLVDWUHJBHQV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|