C15H18N4O3S — CID 2818572
[[amino-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]amino] N,N-dimethylcarbamate (PubChem CID 2818572) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is [[amino-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]amino] N,N-dimethylcarbamate.
| Compound Name | [[amino-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]amino] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 2818572 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [[amino-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]methylidene]amino] N,N-dimethylcarbamate |
| SMILES | Cc1nc(COc2ccc(C(N)=NOC(=O)N(C)C)cc2)cs1 |
| InChI | InChI=1S/C15H18N4O3S/c1-10-17-12(9-23-10)8-21-13-6-4-11(5-7-13)14(16)18-22-15(20)19(2)3/h4-7,9H,8H2,1-3H3,(H2,16,18) |
| InChIKey | RECQXCOLULOJBG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|