C15H16ClN3O3S — CID 76870735
N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide (PubChem CID 76870735) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide.
| Compound Name | N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
|---|---|
| PubChem CID | 76870735 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
| SMILES | Cc1nc(CC(N)=NOCc2cc(Cl)c3c(c2)OCCO3)cs1 |
| InChI | InChI=1S/C15H16ClN3O3S/c1-9-18-11(8-23-9)6-14(17)19-22-7-10-4-12(16)15-13(5-10)20-2-3-21-15/h4-5,8H,2-3,6-7H2,1H3,(H2,17,19) |
| InChIKey | DNWQBWMGOOQHEX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|