C20H23ClN4O3 — CID 97201635
N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-2-piperidin-1-ylpyridine-4-carboximidamide (PubChem CID 97201635) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-2-piperidin-1-ylpyridine-4-carboximidamide.
| Compound Name | N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-2-piperidin-1-ylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 97201635 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-2-piperidin-1-ylpyridine-4-carboximidamide |
| SMILES | N/C(=N\OCc1cc(Cl)c2c(c1)OCCO2)c1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C20H23ClN4O3/c21-16-10-14(11-17-19(16)27-9-8-26-17)13-28-24-20(22)15-4-5-23-18(12-15)25-6-2-1-3-7-25/h4-5,10-12H,1-3,6-9,13H2,(H2,22,24) |
| InChIKey | FRYZTZWCFDZPAK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|