C20H22F3N5O3 — CID 47079156
2-[(E)-[amino-(2-piperidin-1-yl-4-pyridinyl)methylidene]amino]oxy-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 47079156) has the molecular formula C20H22F3N5O3 and a molecular weight of 437.42 g/mol. Its IUPAC name is 2-[(E)-[amino-(2-piperidin-1-yl-4-pyridinyl)methylidene]amino]oxy-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(E)-[amino-(2-piperidin-1-yl-4-pyridinyl)methylidene]amino]oxy-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 47079156 |
| Molecular Formula | C20H22F3N5O3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-[(E)-[amino-(2-piperidin-1-yl-4-pyridinyl)methylidene]amino]oxy-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N/C(=N/OCC(=O)Nc1ccc(OC(F)(F)F)cc1)c1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C20H22F3N5O3/c21-20(22,23)31-16-6-4-15(5-7-16)26-18(29)13-30-27-19(24)14-8-9-25-17(12-14)28-10-2-1-3-11-28/h4-9,12H,1-3,10-11,13H2,(H2,24,27)(H,26,29) |
| InChIKey | CERCZQNBJUAWSI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|