C21H26FN5O2 — CID 72692002
2-[[amino-(2-piperidin-1-yl-4-pyridinyl)methylidene]amino]oxy-N-(3-fluoro-4-methylphenyl)propanamide (PubChem CID 72692002) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[[amino-(2-piperidin-1-yl-4-pyridinyl)methylidene]amino]oxy-N-(3-fluoro-4-methylphenyl)propanamide.
| Compound Name | 2-[[amino-(2-piperidin-1-yl-4-pyridinyl)methylidene]amino]oxy-N-(3-fluoro-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 72692002 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-[[amino-(2-piperidin-1-yl-4-pyridinyl)methylidene]amino]oxy-N-(3-fluoro-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)C(C)ON=C(N)c2ccnc(N3CCCCC3)c2)cc1F |
| InChI | InChI=1S/C21H26FN5O2/c1-14-6-7-17(13-18(14)22)25-21(28)15(2)29-26-20(23)16-8-9-24-19(12-16)27-10-4-3-5-11-27/h6-9,12-13,15H,3-5,10-11H2,1-2H3,(H2,23,26)(H,25,28) |
| InChIKey | MQOJRMGWZHDMHS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|