C21H24F2N4O3 — CID 72692184
2-[[amino-[3-(morpholin-4-ylmethyl)phenyl]methylidene]amino]oxy-N-(3,4-difluorophenyl)propanamide (PubChem CID 72692184) has the molecular formula C21H24F2N4O3 and a molecular weight of 418.44 g/mol. Its IUPAC name is 2-[[amino-[3-(morpholin-4-ylmethyl)phenyl]methylidene]amino]oxy-N-(3,4-difluorophenyl)propanamide.
| Compound Name | 2-[[amino-[3-(morpholin-4-ylmethyl)phenyl]methylidene]amino]oxy-N-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 72692184 |
| Molecular Formula | C21H24F2N4O3 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-[[amino-[3-(morpholin-4-ylmethyl)phenyl]methylidene]amino]oxy-N-(3,4-difluorophenyl)propanamide |
| SMILES | CC(ON=C(N)c1cccc(CN2CCOCC2)c1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H24F2N4O3/c1-14(21(28)25-17-5-6-18(22)19(23)12-17)30-26-20(24)16-4-2-3-15(11-16)13-27-7-9-29-10-8-27/h2-6,11-12,14H,7-10,13H2,1H3,(H2,24,26)(H,25,28) |
| InChIKey | JTTSSMNROKFBTD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|