C25H28N4O4 — CID 134033244
3-[[(Z)-[amino-[3-(morpholin-4-ylmethyl)phenyl]methylidene]amino]oxymethyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 134033244) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[[(Z)-[amino-[3-(morpholin-4-ylmethyl)phenyl]methylidene]amino]oxymethyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[(Z)-[amino-[3-(morpholin-4-ylmethyl)phenyl]methylidene]amino]oxymethyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 134033244 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-[[(Z)-[amino-[3-(morpholin-4-ylmethyl)phenyl]methylidene]amino]oxymethyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | N/C(=N\OCc1cccc(C(=O)NCc2ccco2)c1)c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C25H28N4O4/c26-24(21-6-1-4-19(14-21)17-29-9-12-31-13-10-29)28-33-18-20-5-2-7-22(15-20)25(30)27-16-23-8-3-11-32-23/h1-8,11,14-15H,9-10,12-13,16-18H2,(H2,26,28)(H,27,30) |
| InChIKey | JRGFRMRDNHWRKT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|