C20H24ClN3O3 — CID 126799666
N'-[(3-chloro-4-methoxyphenyl)methoxy]-3-(morpholin-4-ylmethyl)benzenecarboximidamide (PubChem CID 126799666) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is N'-[(3-chloro-4-methoxyphenyl)methoxy]-3-(morpholin-4-ylmethyl)benzenecarboximidamide.
| Compound Name | N'-[(3-chloro-4-methoxyphenyl)methoxy]-3-(morpholin-4-ylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 126799666 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N'-[(3-chloro-4-methoxyphenyl)methoxy]-3-(morpholin-4-ylmethyl)benzenecarboximidamide |
| SMILES | COc1ccc(CON=C(N)c2cccc(CN3CCOCC3)c2)cc1Cl |
| InChI | InChI=1S/C20H24ClN3O3/c1-25-19-6-5-16(12-18(19)21)14-27-23-20(22)17-4-2-3-15(11-17)13-24-7-9-26-10-8-24/h2-6,11-12H,7-10,13-14H2,1H3,(H2,22,23) |
| InChIKey | ZDTKNMOZBSGLOO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|