C20H24FN3O — CID 76870977
N'-[(4-fluorophenyl)methoxy]-3-(piperidin-1-ylmethyl)benzenecarboximidamide (PubChem CID 76870977) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is N'-[(4-fluorophenyl)methoxy]-3-(piperidin-1-ylmethyl)benzenecarboximidamide.
| Compound Name | N'-[(4-fluorophenyl)methoxy]-3-(piperidin-1-ylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 76870977 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N'-[(4-fluorophenyl)methoxy]-3-(piperidin-1-ylmethyl)benzenecarboximidamide |
| SMILES | NC(=NOCc1ccc(F)cc1)c1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C20H24FN3O/c21-19-9-7-16(8-10-19)15-25-23-20(22)18-6-4-5-17(13-18)14-24-11-2-1-3-12-24/h4-10,13H,1-3,11-12,14-15H2,(H2,22,23) |
| InChIKey | VXDNRZJRUYYRGS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|