C21H26FN3O2 — CID 76870968
N'-[2-(4-fluorophenoxy)ethoxy]-3-(piperidin-1-ylmethyl)benzenecarboximidamide (PubChem CID 76870968) has the molecular formula C21H26FN3O2 and a molecular weight of 371.46 g/mol. Its IUPAC name is N'-[2-(4-fluorophenoxy)ethoxy]-3-(piperidin-1-ylmethyl)benzenecarboximidamide.
| Compound Name | N'-[2-(4-fluorophenoxy)ethoxy]-3-(piperidin-1-ylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 76870968 |
| Molecular Formula | C21H26FN3O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N'-[2-(4-fluorophenoxy)ethoxy]-3-(piperidin-1-ylmethyl)benzenecarboximidamide |
| SMILES | NC(=NOCCOc1ccc(F)cc1)c1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C21H26FN3O2/c22-19-7-9-20(10-8-19)26-13-14-27-24-21(23)18-6-4-5-17(15-18)16-25-11-2-1-3-12-25/h4-10,15H,1-3,11-14,16H2,(H2,23,24) |
| InChIKey | XMGAZYHJVAQNIW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|