C22H22F3N5OS — CID 134007980
2-piperidin-1-yl-N'-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]pyridine-4-carboximidamide (PubChem CID 134007980) has the molecular formula C22H22F3N5OS and a molecular weight of 461.51 g/mol. Its IUPAC name is 2-piperidin-1-yl-N'-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]pyridine-4-carboximidamide.
| Compound Name | 2-piperidin-1-yl-N'-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 134007980 |
| Molecular Formula | C22H22F3N5OS |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-piperidin-1-yl-N'-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]pyridine-4-carboximidamide |
| SMILES | N/C(=N\OCc1csc(-c2ccc(C(F)(F)F)cc2)n1)c1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C22H22F3N5OS/c23-22(24,25)17-6-4-15(5-7-17)21-28-18(14-32-21)13-31-29-20(26)16-8-9-27-19(12-16)30-10-2-1-3-11-30/h4-9,12,14H,1-3,10-11,13H2,(H2,26,29) |
| InChIKey | NMKBAFQVHDLJBF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|