C17H18F3N3OS — CID 134028040
N'-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]cyclopentanecarboximidamide (PubChem CID 134028040) has the molecular formula C17H18F3N3OS and a molecular weight of 369.41 g/mol. Its IUPAC name is N'-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]cyclopentanecarboximidamide.
| Compound Name | N'-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 134028040 |
| Molecular Formula | C17H18F3N3OS |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N'-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]cyclopentanecarboximidamide |
| SMILES | N/C(=N\OCc1csc(-c2ccc(C(F)(F)F)cc2)n1)C1CCCC1 |
| InChI | InChI=1S/C17H18F3N3OS/c18-17(19,20)13-7-5-12(6-8-13)16-22-14(10-25-16)9-24-23-15(21)11-3-1-2-4-11/h5-8,10-11H,1-4,9H2,(H2,21,23) |
| InChIKey | DPOGTZUWQZHTFG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|